C16F14O6 — CID 56633487
4,8-bis(1,1,2,2,3,3,3-heptafluoropropyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 56633487) has the molecular formula C16F14O6 and a molecular weight of 554.14 g/mol. Its IUPAC name is 4,8-bis(1,1,2,2,3,3,3-heptafluoropropyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 4,8-bis(1,1,2,2,3,3,3-heptafluoropropyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 56633487 |
| Molecular Formula | C16F14O6 |
| Molecular Weight | 554.14 g/mol |
| Exact Mass | 553.95 |
| IUPAC Name | 4,8-bis(1,1,2,2,3,3,3-heptafluoropropyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | O=c1oc(=O)c2c(C(F)(F)C(F)(F)C(F)(F)F)c3c(=O)oc(=O)c3c(C(F)(F)C(F)(F)C(F)(F)F)c12 |
| InChI | InChI=1S/C16F14O6/c17-11(18,13(21,22)15(25,26)27)5-1-2(8(32)35-7(1)31)6(4-3(5)9(33)36-10(4)34)12(19,20)14(23,24)16(28,29)30 |
| InChIKey | YTYWKRNGHGVFGN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.14 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|