C14H27N3 — CID 56633612
N,N-diethyl-3-(3-imino-1,5-dimethyl-2,4-dihydropyridin-2-yl)propan-1-amine (PubChem CID 56633612) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is N,N-diethyl-3-(3-imino-1,5-dimethyl-2,4-dihydropyridin-2-yl)propan-1-amine.
| Compound Name | N,N-diethyl-3-(3-imino-1,5-dimethyl-2,4-dihydropyridin-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 56633612 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | N,N-diethyl-3-(3-imino-1,5-dimethyl-2,4-dihydropyridin-2-yl)propan-1-amine |
| SMILES | [H]/N=C1\CC(C)=CN(C)C1CCCN(CC)CC |
| InChI | InChI=1S/C14H27N3/c1-5-17(6-2)9-7-8-14-13(15)10-12(3)11-16(14)4/h11,14-15H,5-10H2,1-4H3/b15-13+ |
| InChIKey | CCGMHSUZRWAYJT-FYWRMAATSA-N |
| XLogP | 2.74 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|