C33H58N2O4Si — CID 56633741
benzyl N-[(2S,3S,5S)-5-(butylcarbamoyl)-3-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexyl-6-methylheptan-2-yl]carbamate (PubChem CID 56633741) has the molecular formula C33H58N2O4Si and a molecular weight of 574.92 g/mol. Its IUPAC name is benzyl N-[(2S,3S,5S)-5-(butylcarbamoyl)-3-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexyl-6-methylheptan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S,5S)-5-(butylcarbamoyl)-3-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexyl-6-methylheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 56633741 |
| Molecular Formula | C33H58N2O4Si |
| Molecular Weight | 574.92 g/mol |
| Exact Mass | 574.42 |
| IUPAC Name | benzyl N-[(2S,3S,5S)-5-(butylcarbamoyl)-3-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexyl-6-methylheptan-2-yl]carbamate |
| SMILES | CCCCNC(=O)[C@@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC1CCCCC1)NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C33H58N2O4Si/c1-9-10-21-34-31(36)28(25(2)3)23-30(39-40(7,8)33(4,5)6)29(22-26-17-13-11-14-18-26)35-32(37)38-24-27-19-15-12-16-20-27/h12,15-16,19-20,25-26,28-30H,9-11,13-14,17-18,21-24H2,1-8H3,(H,34,36)(H,35,37)/t28-,29-,30-/m0/s1 |
| InChIKey | JBMRSKBNLXWWMS-DTXPUJKBSA-N |
| XLogP | 8.22 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.92 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|