C18H16N2O3S — CID 56633883
2-methyl-N-(5-methyl-7-oxocyclohepta-1,3,5-trien-1-yl)-4-oxo-3H-1,2-benzothiazine-3-carboxamide (PubChem CID 56633883) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-methyl-N-(5-methyl-7-oxocyclohepta-1,3,5-trien-1-yl)-4-oxo-3H-1,2-benzothiazine-3-carboxamide.
| Compound Name | 2-methyl-N-(5-methyl-7-oxocyclohepta-1,3,5-trien-1-yl)-4-oxo-3H-1,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 56633883 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-methyl-N-(5-methyl-7-oxocyclohepta-1,3,5-trien-1-yl)-4-oxo-3H-1,2-benzothiazine-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)C2C(=O)c3ccccc3SN2C)c(=O)c1 |
| InChI | InChI=1S/C18H16N2O3S/c1-11-6-5-8-13(14(21)10-11)19-18(23)16-17(22)12-7-3-4-9-15(12)24-20(16)2/h3-10,16H,1-2H3,(H,19,21,23) |
| InChIKey | FLXVKGAVQGSFKZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|