C14H10Cl2O2S — CID 56634681
2,3-dichloro-1a,2,3,3a,9a,9b-hexahydroanthra[1,2-b]thiirene-4,9-dione (PubChem CID 56634681) has the molecular formula C14H10Cl2O2S and a molecular weight of 313.21 g/mol. Its IUPAC name is 2,3-dichloro-1a,2,3,3a,9a,9b-hexahydroanthra[1,2-b]thiirene-4,9-dione.
| Compound Name | 2,3-dichloro-1a,2,3,3a,9a,9b-hexahydroanthra[1,2-b]thiirene-4,9-dione |
|---|---|
| PubChem CID | 56634681 |
| Molecular Formula | C14H10Cl2O2S |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 2,3-dichloro-1a,2,3,3a,9a,9b-hexahydroanthra[1,2-b]thiirene-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)C2C3SC3C(Cl)C(Cl)C12 |
| InChI | InChI=1S/C14H10Cl2O2S/c15-9-7-8(13-14(19-13)10(9)16)12(18)6-4-2-1-3-5(6)11(7)17/h1-4,7-10,13-14H |
| InChIKey | RFZWKMYRLIVHRV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|