About S-(4-formylphenyl) N,N-dimethylcarbamothioate
S-(4-formylphenyl) N,N-dimethylcarbamothioate (PubChem CID 56635723) has the molecular formula C10H11NO2S
and a molecular weight of 209.27 g/mol. Its IUPAC name is S-(4-formylphenyl) N,N-dimethylcarbamothioate.
Molecular Properties
| Compound Name | S-(4-formylphenyl) N,N-dimethylcarbamothioate |
| PubChem CID | 56635723 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | S-(4-formylphenyl) N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(C=O)cc1 |
| InChI | InChI=1S/C10H11NO2S/c1-11(2)10(13)14-9-5-3-8(7-12)4-6-9/h3-7H,1-2H3 |
| InChIKey | AVYSFQMOPSDSBK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-formylphenyl) N,N-dimethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-formylphenyl) N,N-dimethylcarbamothioate?
The IUPAC name of S-(4-formylphenyl) N,N-dimethylcarbamothioate (CID 56635723) is S-(4-formylphenyl) N,N-dimethylcarbamothioate.
What is the SMILES notation for S-(4-formylphenyl) N,N-dimethylcarbamothioate?
The canonical SMILES for S-(4-formylphenyl) N,N-dimethylcarbamothioate is CN(C)C(=O)Sc1ccc(C=O)cc1.
What is the InChIKey of S-(4-formylphenyl) N,N-dimethylcarbamothioate?
The InChIKey is AVYSFQMOPSDSBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S/c1-11(2)10(13)14-9-5-3-8(7-12)4-6-9/h3-7H,1-2H3.
What are the key properties of S-(4-formylphenyl) N,N-dimethylcarbamothioate?
S-(4-formylphenyl) N,N-dimethylcarbamothioate has a molecular weight of 209.27 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-formylphenyl) N,N-dimethylcarbamothioate is sourced from PubChem (CID 56635723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).