C21H29F7O4 — CID 56635792
2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-heptoxy-1,3-dioxane (PubChem CID 56635792) has the molecular formula C21H29F7O4 and a molecular weight of 478.45 g/mol. Its IUPAC name is 2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-heptoxy-1,3-dioxane.
| Compound Name | 2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-heptoxy-1,3-dioxane |
|---|---|
| PubChem CID | 56635792 |
| Molecular Formula | C21H29F7O4 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-heptoxy-1,3-dioxane |
| SMILES | CCCCCCCOC1COC(C2=CCC(OC(F)(F)C(F)(F)C(F)(F)CF)C=C2)OC1 |
| InChI | InChI=1S/C21H29F7O4/c1-2-3-4-5-6-11-29-17-12-30-18(31-13-17)15-7-9-16(10-8-15)32-21(27,28)20(25,26)19(23,24)14-22/h7-9,16-18H,2-6,10-14H2,1H3 |
| InChIKey | PDDMEMOAGMOWJZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|