About 1-aminohexa-2,4-dien-1-ol
1-aminohexa-2,4-dien-1-ol (PubChem CID 56635841) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 1-aminohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 1-aminohexa-2,4-dien-1-ol |
| PubChem CID | 56635841 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 1-aminohexa-2,4-dien-1-ol |
| SMILES | CC=CC=CC(N)O |
| InChI | InChI=1S/C6H11NO/c1-2-3-4-5-6(7)8/h2-6,8H,7H2,1H3 |
| InChIKey | QFTQRHGUMGEOMA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-aminohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminohexa-2,4-dien-1-ol?
The IUPAC name of 1-aminohexa-2,4-dien-1-ol (CID 56635841) is 1-aminohexa-2,4-dien-1-ol.
What is the SMILES notation for 1-aminohexa-2,4-dien-1-ol?
The canonical SMILES for 1-aminohexa-2,4-dien-1-ol is CC=CC=CC(N)O.
What is the InChIKey of 1-aminohexa-2,4-dien-1-ol?
The InChIKey is QFTQRHGUMGEOMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-2-3-4-5-6(7)8/h2-6,8H,7H2,1H3.
What are the key properties of 1-aminohexa-2,4-dien-1-ol?
1-aminohexa-2,4-dien-1-ol has a molecular weight of 113.16 g/mol, XLogP of 0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminohexa-2,4-dien-1-ol is sourced from PubChem (CID 56635841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).