About 1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine
1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine (PubChem CID 56636144) has the molecular formula C8H15N7O
and a molecular weight of 225.26 g/mol. Its IUPAC name is 1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine.
Molecular Properties
| Compound Name | 1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine |
| PubChem CID | 56636144 |
| Molecular Formula | C8H15N7O |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine |
| SMILES | COc1nc(C)nc(N=C(N)NN(C)C)n1 |
| InChI | InChI=1S/C8H15N7O/c1-5-10-7(13-8(11-5)16-4)12-6(9)14-15(2)3/h1-4H3,(H3,9,10,11,12,13,14) |
| InChIKey | NMJWMBRQXKEARS-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine?
The IUPAC name of 1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine (CID 56636144) is 1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine.
What is the SMILES notation for 1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine?
The canonical SMILES for 1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine is COc1nc(C)nc(N=C(N)NN(C)C)n1.
What is the InChIKey of 1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine?
The InChIKey is NMJWMBRQXKEARS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N7O/c1-5-10-7(13-8(11-5)16-4)12-6(9)14-15(2)3/h1-4H3,(H3,9,10,11,12,13,14).
What are the key properties of 1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine?
1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine has a molecular weight of 225.26 g/mol, XLogP of -0.80, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)-2-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)guanidine is sourced from PubChem (CID 56636144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).