C18H18O2 — CID 56636210
2-benzylidene-8a-methyl-3,4,7,8-tetrahydronaphthalene-1,6-dione (PubChem CID 56636210) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-benzylidene-8a-methyl-3,4,7,8-tetrahydronaphthalene-1,6-dione.
| Compound Name | 2-benzylidene-8a-methyl-3,4,7,8-tetrahydronaphthalene-1,6-dione |
|---|---|
| PubChem CID | 56636210 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-benzylidene-8a-methyl-3,4,7,8-tetrahydronaphthalene-1,6-dione |
| SMILES | CC12CCC(=O)C=C1CCC(=Cc1ccccc1)C2=O |
| InChI | InChI=1S/C18H18O2/c1-18-10-9-16(19)12-15(18)8-7-14(17(18)20)11-13-5-3-2-4-6-13/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | FKUAYSBLDCGVLH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|