C20H23Br — CID 56636471
3-bromo-7,10-ditert-butyltricyclo[4.2.2.22,5]dodeca-1(9),2,4,6(10),7,11-hexaene (PubChem CID 56636471) has the molecular formula C20H23Br and a molecular weight of 343.31 g/mol. Its IUPAC name is 3-bromo-7,10-ditert-butyltricyclo[4.2.2.22,5]dodeca-1(9),2,4,6(10),7,11-hexaene.
| Compound Name | 3-bromo-7,10-ditert-butyltricyclo[4.2.2.22,5]dodeca-1(9),2,4,6(10),7,11-hexaene |
|---|---|
| PubChem CID | 56636471 |
| Molecular Formula | C20H23Br |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3-bromo-7,10-ditert-butyltricyclo[4.2.2.22,5]dodeca-1(9),2,4,6(10),7,11-hexaene |
| SMILES | CC(C)(C)c1cc2cc(C(C)(C)C)c1-c1ccc-2c(Br)c1 |
| InChI | InChI=1S/C20H23Br/c1-19(2,3)15-9-13-10-16(20(4,5)6)18(15)12-7-8-14(13)17(21)11-12/h7-11H,1-6H3/b14-13-,18-12- |
| InChIKey | DFSRLRXRTYMYRH-YYBCOJIGSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |