C21H33F3O3 — CID 56636713
5-nonyl-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane (PubChem CID 56636713) has the molecular formula C21H33F3O3 and a molecular weight of 390.49 g/mol. Its IUPAC name is 5-nonyl-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane.
| Compound Name | 5-nonyl-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 56636713 |
| Molecular Formula | C21H33F3O3 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 5-nonyl-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
| SMILES | CCCCCCCCCC1COC(C2=CCC(OCC(F)(F)F)C=C2)OC1 |
| InChI | InChI=1S/C21H33F3O3/c1-2-3-4-5-6-7-8-9-17-14-25-20(26-15-17)18-10-12-19(13-11-18)27-16-21(22,23)24/h10-12,17,19-20H,2-9,13-16H2,1H3 |
| InChIKey | CTWSJTXIQKCICW-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|