C22H29F7O — CID 56636745
5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-hexylcyclohexen-1-yl)cyclohexa-1,3-diene (PubChem CID 56636745) has the molecular formula C22H29F7O and a molecular weight of 442.46 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-hexylcyclohexen-1-yl)cyclohexa-1,3-diene.
| Compound Name | 5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-hexylcyclohexen-1-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 56636745 |
| Molecular Formula | C22H29F7O |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-hexylcyclohexen-1-yl)cyclohexa-1,3-diene |
| SMILES | CCCCCCC1CC=C(C2=CCC(OC(F)(F)C(F)(F)C(F)(F)CF)C=C2)CC1 |
| InChI | InChI=1S/C22H29F7O/c1-2-3-4-5-6-16-7-9-17(10-8-16)18-11-13-19(14-12-18)30-22(28,29)21(26,27)20(24,25)15-23/h9,11-13,16,19H,2-8,10,14-15H2,1H3 |
| InChIKey | KTFBELYZQBNTPP-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|