About 1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine
1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine (PubChem CID 56636914) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine.
Molecular Properties
| Compound Name | 1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine |
| PubChem CID | 56636914 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine |
| SMILES | CC1=CN(C)C/C(=N/CC(C)C)C1 |
| InChI | InChI=1S/C11H20N2/c1-9(2)6-12-11-5-10(3)7-13(4)8-11/h7,9H,5-6,8H2,1-4H3/b12-11+ |
| InChIKey | FPPGHGZBRUEPGO-VAWYXSNFSA-N |
| XLogP | 2.32 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine?
The IUPAC name of 1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine (CID 56636914) is 1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine.
What is the SMILES notation for 1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine?
The canonical SMILES for 1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine is CC1=CN(C)C/C(=N/CC(C)C)C1.
What is the InChIKey of 1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine?
The InChIKey is FPPGHGZBRUEPGO-VAWYXSNFSA-N. The full InChI is InChI=1S/C11H20N2/c1-9(2)6-12-11-5-10(3)7-13(4)8-11/h7,9H,5-6,8H2,1-4H3/b12-11+.
What are the key properties of 1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine?
1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine has a molecular weight of 180.29 g/mol, XLogP of 2.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-N-(2-methylpropyl)-2,4-dihydropyridin-3-imine is sourced from PubChem (CID 56636914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).