C20H29F3O — CID 56637028
2-(4-hexylcyclohexen-1-yl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene (PubChem CID 56637028) has the molecular formula C20H29F3O and a molecular weight of 342.45 g/mol. Its IUPAC name is 2-(4-hexylcyclohexen-1-yl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene.
| Compound Name | 2-(4-hexylcyclohexen-1-yl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 56637028 |
| Molecular Formula | C20H29F3O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 2-(4-hexylcyclohexen-1-yl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene |
| SMILES | CCCCCCC1CC=C(C2=CCC(OCC(F)(F)F)C=C2)CC1 |
| InChI | InChI=1S/C20H29F3O/c1-2-3-4-5-6-16-7-9-17(10-8-16)18-11-13-19(14-12-18)24-15-20(21,22)23/h9,11-13,16,19H,2-8,10,14-15H2,1H3 |
| InChIKey | FFVDGXVOBYTFAQ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|