C17H22O6 — CID 56637317
methyl 6-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-4-methylhex-4-enoate (PubChem CID 56637317) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl 6-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-4-methylhex-4-enoate.
| Compound Name | methyl 6-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 56637317 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | methyl 6-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-4-methylhex-4-enoate |
| SMILES | COC(=O)CCC(C)=CCC1=C(C)C(=O)C(OC)=C(OC)C1=O |
| InChI | InChI=1S/C17H22O6/c1-10(7-9-13(18)21-3)6-8-12-11(2)14(19)16(22-4)17(23-5)15(12)20/h6H,7-9H2,1-5H3 |
| InChIKey | IWJFQKJRUBIBJN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|