About ethane;6-hydroxy-1,9-dimethylxanthen-3-one
ethane;6-hydroxy-1,9-dimethylxanthen-3-one (PubChem CID 56637418) has the molecular formula C17H18O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is ethane;6-hydroxy-1,9-dimethylxanthen-3-one.
Molecular Properties
| Compound Name | ethane;6-hydroxy-1,9-dimethylxanthen-3-one |
| PubChem CID | 56637418 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | ethane;6-hydroxy-1,9-dimethylxanthen-3-one |
| SMILES | CC.Cc1cc(=O)cc2oc3cc(O)ccc3c(C)c1-2 |
| InChI | InChI=1S/C15H12O3.C2H6/c1-8-5-11(17)7-14-15(8)9(2)12-4-3-10(16)6-13(12)18-14;1-2/h3-7,16H,1-2H3;1-2H3 |
| InChIKey | CSUMINZREPTBKT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;6-hydroxy-1,9-dimethylxanthen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-hydroxy-1,9-dimethylxanthen-3-one?
The IUPAC name of ethane;6-hydroxy-1,9-dimethylxanthen-3-one (CID 56637418) is ethane;6-hydroxy-1,9-dimethylxanthen-3-one.
What is the SMILES notation for ethane;6-hydroxy-1,9-dimethylxanthen-3-one?
The canonical SMILES for ethane;6-hydroxy-1,9-dimethylxanthen-3-one is CC.Cc1cc(=O)cc2oc3cc(O)ccc3c(C)c1-2.
What is the InChIKey of ethane;6-hydroxy-1,9-dimethylxanthen-3-one?
The InChIKey is CSUMINZREPTBKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O3.C2H6/c1-8-5-11(17)7-14-15(8)9(2)12-4-3-10(16)6-13(12)18-14;1-2/h3-7,16H,1-2H3;1-2H3.
What are the key properties of ethane;6-hydroxy-1,9-dimethylxanthen-3-one?
ethane;6-hydroxy-1,9-dimethylxanthen-3-one has a molecular weight of 270.33 g/mol, XLogP of 4.25, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-hydroxy-1,9-dimethylxanthen-3-one is sourced from PubChem (CID 56637418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).