C19H14F10O3S2 — CID 56637489
[4-(1,1,2,2,3,5,5,6,6,6-decafluorohexylsulfanyl)phenyl] 4-methylbenzenesulfonate (PubChem CID 56637489) has the molecular formula C19H14F10O3S2 and a molecular weight of 544.43 g/mol. Its IUPAC name is [4-(1,1,2,2,3,5,5,6,6,6-decafluorohexylsulfanyl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(1,1,2,2,3,5,5,6,6,6-decafluorohexylsulfanyl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 56637489 |
| Molecular Formula | C19H14F10O3S2 |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 544.02 |
| IUPAC Name | [4-(1,1,2,2,3,5,5,6,6,6-decafluorohexylsulfanyl)phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(SC(F)(F)C(F)(F)C(F)CC(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H14F10O3S2/c1-11-2-8-14(9-3-11)34(30,31)32-12-4-6-13(7-5-12)33-19(28,29)17(23,24)15(20)10-16(21,22)18(25,26)27/h2-9,15H,10H2,1H3 |
| InChIKey | GIEMMBJBQPDDJX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|