C13H12O6 — CID 56637638
(5R)-5-[(1S)-1,2-dihydroxy-3-phenylcyclopropyl]-3-hydroxyoxolane-2,4-dione (PubChem CID 56637638) has the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. Its IUPAC name is (5R)-5-[(1S)-1,2-dihydroxy-3-phenylcyclopropyl]-3-hydroxyoxolane-2,4-dione.
| Compound Name | (5R)-5-[(1S)-1,2-dihydroxy-3-phenylcyclopropyl]-3-hydroxyoxolane-2,4-dione |
|---|---|
| PubChem CID | 56637638 |
| Molecular Formula | C13H12O6 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (5R)-5-[(1S)-1,2-dihydroxy-3-phenylcyclopropyl]-3-hydroxyoxolane-2,4-dione |
| SMILES | O=C1O[C@H]([C@@]2(O)C(O)C2c2ccccc2)C(=O)C1O |
| InChI | InChI=1S/C13H12O6/c14-8-9(15)12(17)19-11(8)13(18)7(10(13)16)6-4-2-1-3-5-6/h1-5,7,9-11,15-16,18H/t7?,9?,10?,11-,13-/m0/s1 |
| InChIKey | QXUVPOPZGWCOMC-CGOJLZOJSA-N |
| XLogP | -1.27 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|