C22H33F5O — CID 56637728
2-(4-heptylcyclohexyl)-5-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,3-diene (PubChem CID 56637728) has the molecular formula C22H33F5O and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-(4-heptylcyclohexyl)-5-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,3-diene.
| Compound Name | 2-(4-heptylcyclohexyl)-5-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 56637728 |
| Molecular Formula | C22H33F5O |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 2-(4-heptylcyclohexyl)-5-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,3-diene |
| SMILES | CCCCCCCC1CCC(C2=CCC(OC(F)(F)C(F)(F)CF)C=C2)CC1 |
| InChI | InChI=1S/C22H33F5O/c1-2-3-4-5-6-7-17-8-10-18(11-9-17)19-12-14-20(15-13-19)28-22(26,27)21(24,25)16-23/h12-14,17-18,20H,2-11,15-16H2,1H3 |
| InChIKey | CAUTXKUEBUJBKK-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|