C21H12F5NO7S — CID 56637829
(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[4-(2,3,4,5,6-pentafluorophenoxy)carbonylphenoxy]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 56637829) has the molecular formula C21H12F5NO7S and a molecular weight of 517.38 g/mol. Its IUPAC name is (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[4-(2,3,4,5,6-pentafluorophenoxy)carbonylphenoxy]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[4-(2,3,4,5,6-pentafluorophenoxy)carbonylphenoxy]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 56637829 |
| Molecular Formula | C21H12F5NO7S |
| Molecular Weight | 517.38 g/mol |
| Exact Mass | 517.03 |
| IUPAC Name | (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[4-(2,3,4,5,6-pentafluorophenoxy)carbonylphenoxy]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(Oc3ccc(C(=O)Oc4c(F)c(F)c(F)c(F)c4F)cc3)S[C@H]12 |
| InChI | InChI=1S/C21H12F5NO7S/c1-6(28)9-17(29)27-15(19(30)31)21(35-18(9)27)33-8-4-2-7(3-5-8)20(32)34-16-13(25)11(23)10(22)12(24)14(16)26/h2-6,9,18,28H,1H3,(H,30,31)/t6-,9+,18-/m1/s1 |
| InChIKey | YCFHZAUBXYUXOQ-VXRHKPIASA-N |
| XLogP | 3.15 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|