C16H18Cl3NO7S — CID 56638212
prop-2-enyl (5R,6S)-3-ethoxy-7-oxo-6-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 56638212) has the molecular formula C16H18Cl3NO7S and a molecular weight of 474.75 g/mol. Its IUPAC name is prop-2-enyl (5R,6S)-3-ethoxy-7-oxo-6-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | prop-2-enyl (5R,6S)-3-ethoxy-7-oxo-6-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 56638212 |
| Molecular Formula | C16H18Cl3NO7S |
| Molecular Weight | 474.75 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | prop-2-enyl (5R,6S)-3-ethoxy-7-oxo-6-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C=CCOC(=O)C1=C(OCC)S[C@@H]2[C@@H](C(C)OC(=O)OCC(Cl)(Cl)Cl)C(=O)N12 |
| InChI | InChI=1S/C16H18Cl3NO7S/c1-4-6-25-13(22)10-14(24-5-2)28-12-9(11(21)20(10)12)8(3)27-15(23)26-7-16(17,18)19/h4,8-9,12H,1,5-7H2,2-3H3/t8?,9-,12+/m0/s1 |
| InChIKey | QDRKJXWNEDCCQQ-BOFGBJPOSA-N |
| XLogP | 3.36 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.75 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|