C12HF5O6 — CID 56638358
8-(1,1,2,2,2-pentafluoroethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 56638358) has the molecular formula C12HF5O6 and a molecular weight of 336.12 g/mol. Its IUPAC name is 8-(1,1,2,2,2-pentafluoroethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 8-(1,1,2,2,2-pentafluoroethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 56638358 |
| Molecular Formula | C12HF5O6 |
| Molecular Weight | 336.12 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 8-(1,1,2,2,2-pentafluoroethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | O=c1oc(=O)c2c(C(F)(F)C(F)(F)F)c3c(=O)oc(=O)c3cc12 |
| InChI | InChI=1S/C12HF5O6/c13-11(14,12(15,16)17)6-4-2(7(18)22-9(4)20)1-3-5(6)10(21)23-8(3)19/h1H |
| InChIKey | FYWVITLJMAQGQI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.12 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|