About 2,6-diimino-1,5-dimethylpiperidin-3-amine
2,6-diimino-1,5-dimethylpiperidin-3-amine (PubChem CID 56638502) has the molecular formula C7H14N4
and a molecular weight of 154.22 g/mol. Its IUPAC name is 2,6-diimino-1,5-dimethylpiperidin-3-amine.
Molecular Properties
| Compound Name | 2,6-diimino-1,5-dimethylpiperidin-3-amine |
| PubChem CID | 56638502 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 2,6-diimino-1,5-dimethylpiperidin-3-amine |
| SMILES | [H]/N=C1/C(N)CC(C)/C(=N\[H])N1C |
| InChI | InChI=1S/C7H14N4/c1-4-3-5(8)7(10)11(2)6(4)9/h4-5,9-10H,3,8H2,1-2H3/b9-6+,10-7- |
| InChIKey | FRGROKALFJYKMW-FPXDHTHPSA-N |
| XLogP | 0.24 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diimino-1,5-dimethylpiperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diimino-1,5-dimethylpiperidin-3-amine?
The IUPAC name of 2,6-diimino-1,5-dimethylpiperidin-3-amine (CID 56638502) is 2,6-diimino-1,5-dimethylpiperidin-3-amine.
What is the SMILES notation for 2,6-diimino-1,5-dimethylpiperidin-3-amine?
The canonical SMILES for 2,6-diimino-1,5-dimethylpiperidin-3-amine is [H]/N=C1/C(N)CC(C)/C(=N\[H])N1C.
What is the InChIKey of 2,6-diimino-1,5-dimethylpiperidin-3-amine?
The InChIKey is FRGROKALFJYKMW-FPXDHTHPSA-N. The full InChI is InChI=1S/C7H14N4/c1-4-3-5(8)7(10)11(2)6(4)9/h4-5,9-10H,3,8H2,1-2H3/b9-6+,10-7-.
What are the key properties of 2,6-diimino-1,5-dimethylpiperidin-3-amine?
2,6-diimino-1,5-dimethylpiperidin-3-amine has a molecular weight of 154.22 g/mol, XLogP of 0.24, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diimino-1,5-dimethylpiperidin-3-amine is sourced from PubChem (CID 56638502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).