C17H15Cl2N9 — CID 56638568
2-[4-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)-methylamino]phenyl]diazenyl]phenyl]guanidine (PubChem CID 56638568) has the molecular formula C17H15Cl2N9 and a molecular weight of 416.28 g/mol. Its IUPAC name is 2-[4-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)-methylamino]phenyl]diazenyl]phenyl]guanidine.
| Compound Name | 2-[4-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)-methylamino]phenyl]diazenyl]phenyl]guanidine |
|---|---|
| PubChem CID | 56638568 |
| Molecular Formula | C17H15Cl2N9 |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 2-[4-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)-methylamino]phenyl]diazenyl]phenyl]guanidine |
| SMILES | CN(c1ccc(/N=N/c2ccc(N=C(N)N)cc2)cc1)c1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C17H15Cl2N9/c1-28(17-24-14(18)23-15(19)25-17)13-8-6-12(7-9-13)27-26-11-4-2-10(3-5-11)22-16(20)21/h2-9H,1H3,(H4,20,21,22)/b27-26+ |
| InChIKey | NGPZHXTXUHFPBD-CYYJNZCTSA-N |
| XLogP | 4.27 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|