C15H15Cl2NO4 — CID 56638650
4-(2,3-dichlorophenyl)-2,6-dimethyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylic acid (PubChem CID 56638650) has the molecular formula C15H15Cl2NO4 and a molecular weight of 344.19 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-2,6-dimethyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-(2,3-dichlorophenyl)-2,6-dimethyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 56638650 |
| Molecular Formula | C15H15Cl2NO4 |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-2,6-dimethyl-2,3,4,5-tetrahydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=NC(C)C(C(=O)O)C(c2cccc(Cl)c2Cl)C1C(=O)O |
| InChI | InChI=1S/C15H15Cl2NO4/c1-6-10(14(19)20)12(11(15(21)22)7(2)18-6)8-4-3-5-9(16)13(8)17/h3-6,10-12H,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | SEBZODCLIHLDFO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |