About 7-propyl-6H-indole
7-propyl-6H-indole (PubChem CID 56638971) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 7-propyl-6H-indole.
Molecular Properties
| Compound Name | 7-propyl-6H-indole |
| PubChem CID | 56638971 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 7-propyl-6H-indole |
| SMILES | CCCC1=C2N=CC=C2C=CC1 |
| InChI | InChI=1S/C11H13N/c1-2-4-9-5-3-6-10-7-8-12-11(9)10/h3,6-8H,2,4-5H2,1H3 |
| InChIKey | MNQBMRAAFPSYFE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-propyl-6H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propyl-6H-indole?
The IUPAC name of 7-propyl-6H-indole (CID 56638971) is 7-propyl-6H-indole.
What is the SMILES notation for 7-propyl-6H-indole?
The canonical SMILES for 7-propyl-6H-indole is CCCC1=C2N=CC=C2C=CC1.
What is the InChIKey of 7-propyl-6H-indole?
The InChIKey is MNQBMRAAFPSYFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-2-4-9-5-3-6-10-7-8-12-11(9)10/h3,6-8H,2,4-5H2,1H3.
What are the key properties of 7-propyl-6H-indole?
7-propyl-6H-indole has a molecular weight of 159.23 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propyl-6H-indole is sourced from PubChem (CID 56638971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).