C23H38O6 — CID 56639199
methyl 7-[(3aR,5R,6R,6aR)-2,2-dimethyl-5-(3-oxooct-1-enyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]heptanoate (PubChem CID 56639199) has the molecular formula C23H38O6 and a molecular weight of 410.55 g/mol. Its IUPAC name is methyl 7-[(3aR,5R,6R,6aR)-2,2-dimethyl-5-(3-oxooct-1-enyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]heptanoate.
| Compound Name | methyl 7-[(3aR,5R,6R,6aR)-2,2-dimethyl-5-(3-oxooct-1-enyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]heptanoate |
|---|---|
| PubChem CID | 56639199 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | methyl 7-[(3aR,5R,6R,6aR)-2,2-dimethyl-5-(3-oxooct-1-enyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]heptanoate |
| SMILES | CCCCCC(=O)C=C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C23H38O6/c1-5-6-9-12-17(24)15-16-19-18(13-10-7-8-11-14-20(25)26-4)21-22(27-19)29-23(2,3)28-21/h15-16,18-19,21-22H,5-14H2,1-4H3/t18-,19-,21-,22-/m1/s1 |
| InChIKey | VRXCZHTTZDBYMB-UGESXGAOSA-N |
| XLogP | 4.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|