C8H10N2O5 — CID 56639289
methyl 1-(2-amino-2-oxoethyl)-2,4-dioxopyrrolidine-3-carboxylate (PubChem CID 56639289) has the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. Its IUPAC name is methyl 1-(2-amino-2-oxoethyl)-2,4-dioxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(2-amino-2-oxoethyl)-2,4-dioxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 56639289 |
| Molecular Formula | C8H10N2O5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | methyl 1-(2-amino-2-oxoethyl)-2,4-dioxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1C(=O)CN(CC(N)=O)C1=O |
| InChI | InChI=1S/C8H10N2O5/c1-15-8(14)6-4(11)2-10(7(6)13)3-5(9)12/h6H,2-3H2,1H3,(H2,9,12) |
| InChIKey | ROPPOQPQUITEOY-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|