About 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol
3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol (PubChem CID 56639570) has the molecular formula C15H15NO
and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol.
Molecular Properties
| Compound Name | 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol |
| PubChem CID | 56639570 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol |
| SMILES | N[C@H]1C[C@@H]1c1ccc(-c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C15H15NO/c16-15-9-14(15)11-6-4-10(5-7-11)12-2-1-3-13(17)8-12/h1-8,14-15,17H,9,16H2/t14-,15+/m1/s1 |
| InChIKey | DSOJSZXQRJGBCW-CABCVRRESA-N |
| XLogP | 2.87 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol?
The IUPAC name of 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol (CID 56639570) is 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol.
What is the SMILES notation for 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol?
The canonical SMILES for 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol is N[C@H]1C[C@@H]1c1ccc(-c2cccc(O)c2)cc1.
What is the InChIKey of 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol?
The InChIKey is DSOJSZXQRJGBCW-CABCVRRESA-N. The full InChI is InChI=1S/C15H15NO/c16-15-9-14(15)11-6-4-10(5-7-11)12-2-1-3-13(17)8-12/h1-8,14-15,17H,9,16H2/t14-,15+/m1/s1.
What are the key properties of 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol?
3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol has a molecular weight of 225.29 g/mol, XLogP of 2.87, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol is sourced from PubChem (CID 56639570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).