C25H26BrClN2O3S2 — CID 56639602
3-bromo-5-chloro-4-[1-(4-ethylphenyl)piperidin-4-yl]oxy-1-(4-methylsulfonylphenyl)pyridine-2-thione (PubChem CID 56639602) has the molecular formula C25H26BrClN2O3S2 and a molecular weight of 581.99 g/mol. Its IUPAC name is 3-bromo-5-chloro-4-[1-(4-ethylphenyl)piperidin-4-yl]oxy-1-(4-methylsulfonylphenyl)pyridine-2-thione.
| Compound Name | 3-bromo-5-chloro-4-[1-(4-ethylphenyl)piperidin-4-yl]oxy-1-(4-methylsulfonylphenyl)pyridine-2-thione |
|---|---|
| PubChem CID | 56639602 |
| Molecular Formula | C25H26BrClN2O3S2 |
| Molecular Weight | 581.99 g/mol |
| Exact Mass | 580.03 |
| IUPAC Name | 3-bromo-5-chloro-4-[1-(4-ethylphenyl)piperidin-4-yl]oxy-1-(4-methylsulfonylphenyl)pyridine-2-thione |
| SMILES | CCc1ccc(N2CCC(Oc3c(Cl)cn(-c4ccc(S(C)(=O)=O)cc4)c(=S)c3Br)CC2)cc1 |
| InChI | InChI=1S/C25H26BrClN2O3S2/c1-3-17-4-6-18(7-5-17)28-14-12-20(13-15-28)32-24-22(27)16-29(25(33)23(24)26)19-8-10-21(11-9-19)34(2,30)31/h4-11,16,20H,3,12-15H2,1-2H3 |
| InChIKey | VXNKDTFNXWITSN-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.99 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|