C19H14F4N4O4 — CID 56639759
(6S)-6-[[2-fluoro-4-[5-(trifluoromethyl)-2-pyridinyl]phenyl]methoxy]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 56639759) has the molecular formula C19H14F4N4O4 and a molecular weight of 438.34 g/mol. Its IUPAC name is (6S)-6-[[2-fluoro-4-[5-(trifluoromethyl)-2-pyridinyl]phenyl]methoxy]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | (6S)-6-[[2-fluoro-4-[5-(trifluoromethyl)-2-pyridinyl]phenyl]methoxy]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 56639759 |
| Molecular Formula | C19H14F4N4O4 |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | (6S)-6-[[2-fluoro-4-[5-(trifluoromethyl)-2-pyridinyl]phenyl]methoxy]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCc1ccc(-c3ccc(C(F)(F)F)cn3)cc1F)C2 |
| InChI | InChI=1S/C19H14F4N4O4/c20-15-5-11(16-4-3-13(6-24-16)19(21,22)23)1-2-12(15)9-30-14-7-26-8-17(27(28)29)25-18(26)31-10-14/h1-6,8,14H,7,9-10H2/t14-/m0/s1 |
| InChIKey | XQXUVNHTKBBBAL-AWEZNQCLSA-N |
| XLogP | 3.99 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|