C33H45F3N6O3 — CID 56639961
2-[4,6-bis(dimethylamino)-2-[[4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]methyl]pyrimidin-5-yl]acetate;tetraethylazanium (PubChem CID 56639961) has the molecular formula C33H45F3N6O3 and a molecular weight of 630.76 g/mol. Its IUPAC name is 2-[4,6-bis(dimethylamino)-2-[[4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]methyl]pyrimidin-5-yl]acetate;tetraethylazanium.
| Compound Name | 2-[4,6-bis(dimethylamino)-2-[[4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]methyl]pyrimidin-5-yl]acetate;tetraethylazanium |
|---|---|
| PubChem CID | 56639961 |
| Molecular Formula | C33H45F3N6O3 |
| Molecular Weight | 630.76 g/mol |
| Exact Mass | 630.35 |
| IUPAC Name | 2-[4,6-bis(dimethylamino)-2-[[4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]methyl]pyrimidin-5-yl]acetate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.CN(C)c1nc(Cc2ccc(NC(=O)c3ccc(C(F)(F)F)cc3)cc2)nc(N(C)C)c1CC(=O)[O-] |
| InChI | InChI=1S/C25H26F3N5O3.C8H20N/c1-32(2)22-19(14-21(34)35)23(33(3)4)31-20(30-22)13-15-5-11-18(12-6-15)29-24(36)16-7-9-17(10-8-16)25(26,27)28;1-5-9(6-2,7-3)8-4/h5-12H,13-14H2,1-4H3,(H,29,36)(H,34,35);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | KUVPIWVKPHZELN-UHFFFAOYSA-M |
| XLogP | 4.65 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.76 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|