C7H11NO — CID 566402
1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 566402) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | 1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 566402 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | O=C1CCC2CCCN12 |
| InChI | InChI=1S/C7H11NO/c9-7-4-3-6-2-1-5-8(6)7/h6H,1-5H2 |
| InChIKey | KSSXTPBFMJHPIR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |