About 3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one
3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one (PubChem CID 56640290) has the molecular formula C16H14O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one.
Molecular Properties
| Compound Name | 3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one |
| PubChem CID | 56640290 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one |
| SMILES | C=Cc1cccc(-c2coc3c2C(=O)CCC3)c1 |
| InChI | InChI=1S/C16H14O2/c1-2-11-5-3-6-12(9-11)13-10-18-15-8-4-7-14(17)16(13)15/h2-3,5-6,9-10H,1,4,7-8H2 |
| InChIKey | PCINFRVVNUXPFQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one?
The IUPAC name of 3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one (CID 56640290) is 3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one.
What is the SMILES notation for 3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one?
The canonical SMILES for 3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one is C=Cc1cccc(-c2coc3c2C(=O)CCC3)c1.
What is the InChIKey of 3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one?
The InChIKey is PCINFRVVNUXPFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O2/c1-2-11-5-3-6-12(9-11)13-10-18-15-8-4-7-14(17)16(13)15/h2-3,5-6,9-10H,1,4,7-8H2.
What are the key properties of 3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one?
3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one has a molecular weight of 238.29 g/mol, XLogP of 4.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-ethenylphenyl)-6,7-dihydro-5H-1-benzofuran-4-one is sourced from PubChem (CID 56640290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).