C21H14N4O3 — CID 56640442
4-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-1H-benzo[f]quinoxaline-2,3-dione (PubChem CID 56640442) has the molecular formula C21H14N4O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is 4-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-1H-benzo[f]quinoxaline-2,3-dione.
| Compound Name | 4-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-1H-benzo[f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 56640442 |
| Molecular Formula | C21H14N4O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 4-[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-1H-benzo[f]quinoxaline-2,3-dione |
| SMILES | Cc1noc(-c2cccc(-n3c(=O)c(=O)[nH]c4c5ccccc5ccc43)c2)n1 |
| InChI | InChI=1S/C21H14N4O3/c1-12-22-20(28-24-12)14-6-4-7-15(11-14)25-17-10-9-13-5-2-3-8-16(13)18(17)23-19(26)21(25)27/h2-11H,1H3,(H,23,26) |
| InChIKey | NMNHIIAYOHWXDD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|