C24H28N2O5 — CID 56640606
7-[3-(4-ethoxypiperazin-1-yl)-2-hydroxypropoxy]-3-phenylchromen-4-one (PubChem CID 56640606) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 7-[3-(4-ethoxypiperazin-1-yl)-2-hydroxypropoxy]-3-phenylchromen-4-one.
| Compound Name | 7-[3-(4-ethoxypiperazin-1-yl)-2-hydroxypropoxy]-3-phenylchromen-4-one |
|---|---|
| PubChem CID | 56640606 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 7-[3-(4-ethoxypiperazin-1-yl)-2-hydroxypropoxy]-3-phenylchromen-4-one |
| SMILES | CCON1CCN(CC(O)COc2ccc3c(=O)c(-c4ccccc4)coc3c2)CC1 |
| InChI | InChI=1S/C24H28N2O5/c1-2-31-26-12-10-25(11-13-26)15-19(27)16-29-20-8-9-21-23(14-20)30-17-22(24(21)28)18-6-4-3-5-7-18/h3-9,14,17,19,27H,2,10-13,15-16H2,1H3 |
| InChIKey | CVTJJWFSMTXRLG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |