About 3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid
3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid (PubChem CID 56640714) has the molecular formula C25H23F2NO5
and a molecular weight of 455.46 g/mol. Its IUPAC name is 3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid |
| PubChem CID | 56640714 |
| Molecular Formula | C25H23F2NO5 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid |
| SMILES | CO/N=C(\COc1ccc(COc2cc(F)c(CCC(=O)O)cc2F)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H23F2NO5/c1-31-28-23(18-5-3-2-4-6-18)16-32-20-10-7-17(8-11-20)15-33-24-14-21(26)19(13-22(24)27)9-12-25(29)30/h2-8,10-11,13-14H,9,12,15-16H2,1H3,(H,29,30)/b28-23+ |
| InChIKey | ARBVIFZMVXNFNL-WEMUOSSPSA-N |
| XLogP | 4.99 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid?
The IUPAC name of 3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid (CID 56640714) is 3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid.
What is the SMILES notation for 3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid?
The canonical SMILES for 3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid is CO/N=C(\COc1ccc(COc2cc(F)c(CCC(=O)O)cc2F)cc1)c1ccccc1.
What is the InChIKey of 3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid?
The InChIKey is ARBVIFZMVXNFNL-WEMUOSSPSA-N. The full InChI is InChI=1S/C25H23F2NO5/c1-31-28-23(18-5-3-2-4-6-18)16-32-20-10-7-17(8-11-20)15-33-24-14-21(26)19(13-22(24)27)9-12-25(29)30/h2-8,10-11,13-14H,9,12,15-16H2,1H3,(H,29,30)/b28-23+.
What are the key properties of 3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid?
3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid has a molecular weight of 455.46 g/mol, XLogP of 4.99, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,5-difluoro-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid is sourced from PubChem (CID 56640714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).