About (2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide
(2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide (PubChem CID 56640992) has the molecular formula C17H14BrNO
and a molecular weight of 328.21 g/mol. Its IUPAC name is (2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide.
Molecular Properties
| Compound Name | (2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide |
| PubChem CID | 56640992 |
| Molecular Formula | C17H14BrNO |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | (2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C/c1ccccc1)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C17H14BrNO/c18-15-10-6-11-16(13-15)19-17(20)12-5-4-9-14-7-2-1-3-8-14/h1-13H,(H,19,20)/b9-4+,12-5+ |
| InChIKey | CEUCMTQBWWGOGK-XFRMRLMGSA-N |
| XLogP | 4.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide?
The IUPAC name of (2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide (CID 56640992) is (2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide.
What is the SMILES notation for (2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide?
The canonical SMILES for (2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide is O=C(/C=C/C=C/c1ccccc1)Nc1cccc(Br)c1.
What is the InChIKey of (2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide?
The InChIKey is CEUCMTQBWWGOGK-XFRMRLMGSA-N. The full InChI is InChI=1S/C17H14BrNO/c18-15-10-6-11-16(13-15)19-17(20)12-5-4-9-14-7-2-1-3-8-14/h1-13H,(H,19,20)/b9-4+,12-5+.
What are the key properties of (2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide?
(2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide has a molecular weight of 328.21 g/mol, XLogP of 4.66, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-N-(3-bromophenyl)-5-phenylpenta-2,4-dienamide is sourced from PubChem (CID 56640992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).