C30H48O2 — CID 56641218
[2,6-di(propan-2-yl)phenyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 56641218) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 56641218 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)Oc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C30H48O2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-29(31)32-30-27(25(2)3)22-21-23-28(30)26(4)5/h10-11,13-14,21-23,25-26H,6-9,12,15-20,24H2,1-5H3/b11-10-,14-13- |
| InChIKey | ISQFTVNKQIPPCZ-XVTLYKPTSA-N |
| XLogP | 9.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|