About bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+)
bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+) (PubChem CID 56641298) has the molecular formula C14H24CoN2O6S2
and a molecular weight of 439.42 g/mol. Its IUPAC name is bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+).
Molecular Properties
| Compound Name | bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+) |
| PubChem CID | 56641298 |
| Molecular Formula | C14H24CoN2O6S2 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+) |
| SMILES | CSCC[C@H](NC(C)=O)C(=O)[O-].CSCC[C@H](NC(C)=O)C(=O)[O-].[Co+2] |
| InChI | InChI=1S/2C7H13NO3S.Co/c2*1-5(9)8-6(7(10)11)3-4-12-2;/h2*6H,3-4H2,1-2H3,(H,8,9)(H,10,11);/q;;+2/p-2/t2*6-;/m00./s1 |
| InChIKey | FNKYXRYEKDLGDY-UAIGZDOSSA-L |
| XLogP | -2.01 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+)?
The IUPAC name of bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+) (CID 56641298) is bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+).
What is the SMILES notation for bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+)?
The canonical SMILES for bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+) is CSCC[C@H](NC(C)=O)C(=O)[O-].CSCC[C@H](NC(C)=O)C(=O)[O-].[Co+2].
What is the InChIKey of bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+)?
The InChIKey is FNKYXRYEKDLGDY-UAIGZDOSSA-L. The full InChI is InChI=1S/2C7H13NO3S.Co/c2*1-5(9)8-6(7(10)11)3-4-12-2;/h2*6H,3-4H2,1-2H3,(H,8,9)(H,10,11);/q;;+2/p-2/t2*6-;/m00./s1.
What are the key properties of bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+)?
bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+) has a molecular weight of 439.42 g/mol, XLogP of -2.01, 10 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis((2S)-2-acetamido-4-methylsulfanylbutanoate);cobalt(2+) is sourced from PubChem (CID 56641298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).