C12H18BrNO3S — CID 56641308
(NE,R)-N-(2-bromo-4,4-dimethoxycyclohexa-2,5-dien-1-ylidene)-2-methylpropane-2-sulfinamide (PubChem CID 56641308) has the molecular formula C12H18BrNO3S and a molecular weight of 336.25 g/mol. Its IUPAC name is (NE,R)-N-(2-bromo-4,4-dimethoxycyclohexa-2,5-dien-1-ylidene)-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-(2-bromo-4,4-dimethoxycyclohexa-2,5-dien-1-ylidene)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 56641308 |
| Molecular Formula | C12H18BrNO3S |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | (NE,R)-N-(2-bromo-4,4-dimethoxycyclohexa-2,5-dien-1-ylidene)-2-methylpropane-2-sulfinamide |
| SMILES | COC1(OC)C=C/C(=N\[S@](=O)C(C)(C)C)C(Br)=C1 |
| InChI | InChI=1S/C12H18BrNO3S/c1-11(2,3)18(15)14-10-6-7-12(16-4,17-5)8-9(10)13/h6-8H,1-5H3/b14-10+/t18-/m1/s1 |
| InChIKey | UDCOWDJPNVWMTH-PMXLPMHFSA-N |
| XLogP | 2.73 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|