C35H50O5Si — CID 56641441
2-[(2R,4S,5S,8S,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-formyl-4,8-dimethyl-1-oxaspiro[4.4]nonan-9-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 56641441) has the molecular formula C35H50O5Si and a molecular weight of 578.87 g/mol. Its IUPAC name is 2-[(2R,4S,5S,8S,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-formyl-4,8-dimethyl-1-oxaspiro[4.4]nonan-9-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(2R,4S,5S,8S,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-formyl-4,8-dimethyl-1-oxaspiro[4.4]nonan-9-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 56641441 |
| Molecular Formula | C35H50O5Si |
| Molecular Weight | 578.87 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | 2-[(2R,4S,5S,8S,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-formyl-4,8-dimethyl-1-oxaspiro[4.4]nonan-9-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | C[C@H]1C[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@]12CC[C@](C)(C=O)[C@H]2CCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C35H50O5Si/c1-26-23-27(40-35(26)21-20-34(8,25-36)30(35)19-22-38-31(37)32(2,3)4)24-39-41(33(5,6)7,28-15-11-9-12-16-28)29-17-13-10-14-18-29/h9-18,25-27,30H,19-24H2,1-8H3/t26-,27+,30+,34+,35-/m0/s1 |
| InChIKey | HKQQRQRXCVDCFL-MYQJQZSQSA-N |
| XLogP | 6.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.87 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|