C19H26NS+ — CID 56641525
3-[2,6-di(propan-2-yl)phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium (PubChem CID 56641525) has the molecular formula C19H26NS+ and a molecular weight of 300.49 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium.
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 56641525 |
| Molecular Formula | C19H26NS+ |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium |
| SMILES | CC(C)c1cccc(C(C)C)c1-[n+]1csc2c1CCCC2 |
| InChI | InChI=1S/C19H26NS/c1-13(2)15-8-7-9-16(14(3)4)19(15)20-12-21-18-11-6-5-10-17(18)20/h7-9,12-14H,5-6,10-11H2,1-4H3/q+1 |
| InChIKey | DNOOGABWWZMXIS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|