About 12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one
12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one (PubChem CID 56641534) has the molecular formula C17H15NO2
and a molecular weight of 265.31 g/mol. Its IUPAC name is 12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one.
Molecular Properties
| Compound Name | 12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one |
| PubChem CID | 56641534 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one |
| SMILES | Cc1ccc2c(c1)CCN1C(=O)c3ccccc3C21O |
| InChI | InChI=1S/C17H15NO2/c1-11-6-7-14-12(10-11)8-9-18-16(19)13-4-2-3-5-15(13)17(14,18)20/h2-7,10,20H,8-9H2,1H3 |
| InChIKey | TYGRLQCEEQQXHM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one?
The IUPAC name of 12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one (CID 56641534) is 12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one.
What is the SMILES notation for 12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one?
The canonical SMILES for 12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one is Cc1ccc2c(c1)CCN1C(=O)c3ccccc3C21O.
What is the InChIKey of 12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one?
The InChIKey is TYGRLQCEEQQXHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2/c1-11-6-7-14-12(10-11)8-9-18-16(19)13-4-2-3-5-15(13)17(14,18)20/h2-7,10,20H,8-9H2,1H3.
What are the key properties of 12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one?
12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one has a molecular weight of 265.31 g/mol, XLogP of 2.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12b-hydroxy-3-methyl-5,6-dihydroisoindolo[1,2-a]isoquinolin-8-one is sourced from PubChem (CID 56641534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).