C9H16F3NO2S — CID 56641582
(2R,3R)-2,3-dipropyl-1-(trifluoromethylsulfonyl)aziridine (PubChem CID 56641582) has the molecular formula C9H16F3NO2S and a molecular weight of 259.29 g/mol. Its IUPAC name is (2R,3R)-2,3-dipropyl-1-(trifluoromethylsulfonyl)aziridine.
| Compound Name | (2R,3R)-2,3-dipropyl-1-(trifluoromethylsulfonyl)aziridine |
|---|---|
| PubChem CID | 56641582 |
| Molecular Formula | C9H16F3NO2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (2R,3R)-2,3-dipropyl-1-(trifluoromethylsulfonyl)aziridine |
| SMILES | CCC[C@@H]1[C@@H](CCC)N1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2S/c1-3-5-7-8(6-4-2)13(7)16(14,15)9(10,11)12/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | PTTLHDPXZQADGX-HTQZYQBOSA-N |
| XLogP | 2.49 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|