C23H21N3O3S — CID 56641686
3-[(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-2-[(1S)-1-hydroxyethyl]quinazolin-4-one (PubChem CID 56641686) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is 3-[(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-2-[(1S)-1-hydroxyethyl]quinazolin-4-one.
| Compound Name | 3-[(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-2-[(1S)-1-hydroxyethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 56641686 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 3-[(benzyl-oxo-phenyl-λ6-sulfanylidene)amino]-2-[(1S)-1-hydroxyethyl]quinazolin-4-one |
| SMILES | C[C@H](O)c1nc2ccccc2c(=O)n1N=[S@@](=O)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21N3O3S/c1-17(27)22-24-21-15-9-8-14-20(21)23(28)26(22)25-30(29,19-12-6-3-7-13-19)16-18-10-4-2-5-11-18/h2-15,17,27H,16H2,1H3/t17-,30+/m0/s1 |
| InChIKey | BHRGSUUMBKQJQV-NOVUIFNWSA-N |
| XLogP | 3.94 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |