C25H24N2O — CID 56641869
(4aR,5S,10bR)-5-(9-methylcarbazol-3-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 56641869) has the molecular formula C25H24N2O and a molecular weight of 368.48 g/mol. Its IUPAC name is (4aR,5S,10bR)-5-(9-methylcarbazol-3-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aR,5S,10bR)-5-(9-methylcarbazol-3-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 56641869 |
| Molecular Formula | C25H24N2O |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (4aR,5S,10bR)-5-(9-methylcarbazol-3-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | Cn1c2ccccc2c2cc([C@H]3Nc4ccccc4[C@@H]4OCCC[C@H]34)ccc21 |
| InChI | InChI=1S/C25H24N2O/c1-27-22-11-5-3-7-17(22)20-15-16(12-13-23(20)27)24-19-9-6-14-28-25(19)18-8-2-4-10-21(18)26-24/h2-5,7-8,10-13,15,19,24-26H,6,9,14H2,1H3/t19-,24-,25+/m1/s1 |
| InChIKey | IXTQJQJPDRZVRA-WVQWTBLQSA-N |
| XLogP | 5.97 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |