C15H14N2O4 — CID 56642242
methyl 5-hydroxy-9-methylidene-10-oxo-3,11-diazatricyclo[6.5.1.04,14]tetradeca-1,4,6,8(14)-tetraene-12-carboxylate (PubChem CID 56642242) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is methyl 5-hydroxy-9-methylidene-10-oxo-3,11-diazatricyclo[6.5.1.04,14]tetradeca-1,4,6,8(14)-tetraene-12-carboxylate.
| Compound Name | methyl 5-hydroxy-9-methylidene-10-oxo-3,11-diazatricyclo[6.5.1.04,14]tetradeca-1,4,6,8(14)-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 56642242 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | methyl 5-hydroxy-9-methylidene-10-oxo-3,11-diazatricyclo[6.5.1.04,14]tetradeca-1,4,6,8(14)-tetraene-12-carboxylate |
| SMILES | C=C1C(=O)NC(C(=O)OC)Cc2c[nH]c3c(O)ccc1c23 |
| InChI | InChI=1S/C15H14N2O4/c1-7-9-3-4-11(18)13-12(9)8(6-16-13)5-10(15(20)21-2)17-14(7)19/h3-4,6,10,16,18H,1,5H2,2H3,(H,17,19) |
| InChIKey | JKOLCXJUTHFXJT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|