C25H27F2NO2S — CID 56642312
2-(2,4-difluorophenyl)-4-(7-octyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)pyridine (PubChem CID 56642312) has the molecular formula C25H27F2NO2S and a molecular weight of 443.56 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-4-(7-octyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)pyridine.
| Compound Name | 2-(2,4-difluorophenyl)-4-(7-octyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)pyridine |
|---|---|
| PubChem CID | 56642312 |
| Molecular Formula | C25H27F2NO2S |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-(2,4-difluorophenyl)-4-(7-octyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)pyridine |
| SMILES | CCCCCCCCc1sc(-c2ccnc(-c3ccc(F)cc3F)c2)c2c1OCCO2 |
| InChI | InChI=1S/C25H27F2NO2S/c1-2-3-4-5-6-7-8-22-23-24(30-14-13-29-23)25(31-22)17-11-12-28-21(15-17)19-10-9-18(26)16-20(19)27/h9-12,15-16H,2-8,13-14H2,1H3 |
| InChIKey | OAPJKDXFHCBXMY-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|